N,N-diethyl-5-methyl-4-nitro-1,2-oxazole-3-carboxamide
Chemical Structure Depiction of
N,N-diethyl-5-methyl-4-nitro-1,2-oxazole-3-carboxamide
N,N-diethyl-5-methyl-4-nitro-1,2-oxazole-3-carboxamide
Compound characteristics
| Compound ID: | C582-0832 |
| Compound Name: | N,N-diethyl-5-methyl-4-nitro-1,2-oxazole-3-carboxamide |
| Molecular Weight: | 227.22 |
| Molecular Formula: | C9 H13 N3 O4 |
| Smiles: | CCN(CC)C(c1c(c(C)on1)[N+]([O-])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 0.892 |
| logD: | 0.892 |
| logSw: | -0.8326 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 71.182 |
| InChI Key: | VZLAEADMFINUMU-UHFFFAOYSA-N |