N-(2,4-dimethylphenyl)-8-methoxy-3-(4-methylbenzene-1-sulfonyl)-2H-1-benzopyran-2-imine
Chemical Structure Depiction of
N-(2,4-dimethylphenyl)-8-methoxy-3-(4-methylbenzene-1-sulfonyl)-2H-1-benzopyran-2-imine
N-(2,4-dimethylphenyl)-8-methoxy-3-(4-methylbenzene-1-sulfonyl)-2H-1-benzopyran-2-imine
Compound characteristics
| Compound ID: | C585-0186 |
| Compound Name: | N-(2,4-dimethylphenyl)-8-methoxy-3-(4-methylbenzene-1-sulfonyl)-2H-1-benzopyran-2-imine |
| Molecular Weight: | 433.53 |
| Molecular Formula: | C25 H23 N O4 S |
| Smiles: | Cc1ccc(cc1)S(C1=Cc2cccc(c2OC/1=N/c1ccc(C)cc1C)OC)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.7947 |
| logD: | 5.7939 |
| logSw: | -5.6006 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 52.063 |
| InChI Key: | FGWMVLZLMWKFRU-UHFFFAOYSA-N |