(3,5-dimethylpiperidin-1-yl)[3-(4-methylphenyl)-1H-pyrazol-5-yl]methanone
Chemical Structure Depiction of
(3,5-dimethylpiperidin-1-yl)[3-(4-methylphenyl)-1H-pyrazol-5-yl]methanone
(3,5-dimethylpiperidin-1-yl)[3-(4-methylphenyl)-1H-pyrazol-5-yl]methanone
Compound characteristics
| Compound ID: | C590-0101 |
| Compound Name: | (3,5-dimethylpiperidin-1-yl)[3-(4-methylphenyl)-1H-pyrazol-5-yl]methanone |
| Molecular Weight: | 297.4 |
| Molecular Formula: | C18 H23 N3 O |
| Smiles: | CC1CC(C)CN(C1)C(c1cc(c2ccc(C)cc2)n[nH]1)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 4.3807 |
| logD: | 4.3801 |
| logSw: | -4.2144 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.243 |
| InChI Key: | BHDRUTUQAXIKAH-UHFFFAOYSA-N |