[3-(2-methoxyphenyl)-1H-pyrazol-5-yl][3-methyl-4-(3-methylphenyl)piperazin-1-yl]methanone
Chemical Structure Depiction of
[3-(2-methoxyphenyl)-1H-pyrazol-5-yl][3-methyl-4-(3-methylphenyl)piperazin-1-yl]methanone
[3-(2-methoxyphenyl)-1H-pyrazol-5-yl][3-methyl-4-(3-methylphenyl)piperazin-1-yl]methanone
Compound characteristics
| Compound ID: | C590-0235 |
| Compound Name: | [3-(2-methoxyphenyl)-1H-pyrazol-5-yl][3-methyl-4-(3-methylphenyl)piperazin-1-yl]methanone |
| Molecular Weight: | 390.48 |
| Molecular Formula: | C23 H26 N4 O2 |
| Smiles: | CC1CN(CCN1c1cccc(C)c1)C(c1cc(c2ccccc2OC)n[nH]1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.1467 |
| logD: | 4.1461 |
| logSw: | -4.2386 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.486 |
| InChI Key: | LZHUZDPJMLWXFM-KRWDZBQOSA-N |