(azepan-1-yl)[3-(2-methoxyphenyl)-1H-pyrazol-5-yl]methanone
Chemical Structure Depiction of
(azepan-1-yl)[3-(2-methoxyphenyl)-1H-pyrazol-5-yl]methanone
(azepan-1-yl)[3-(2-methoxyphenyl)-1H-pyrazol-5-yl]methanone
Compound characteristics
| Compound ID: | C590-0273 |
| Compound Name: | (azepan-1-yl)[3-(2-methoxyphenyl)-1H-pyrazol-5-yl]methanone |
| Molecular Weight: | 299.37 |
| Molecular Formula: | C17 H21 N3 O2 |
| Smiles: | COc1ccccc1c1cc(C(N2CCCCCC2)=O)[nH]n1 |
| Stereo: | ACHIRAL |
| logP: | 3.1274 |
| logD: | 3.1269 |
| logSw: | -3.4799 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.338 |
| InChI Key: | IFWLQRMBPDGXKZ-UHFFFAOYSA-N |