4-chloro-N-[(3-chlorophenyl)methyl]thieno[3,2-c]quinoline-2-carboxamide
Chemical Structure Depiction of
4-chloro-N-[(3-chlorophenyl)methyl]thieno[3,2-c]quinoline-2-carboxamide
4-chloro-N-[(3-chlorophenyl)methyl]thieno[3,2-c]quinoline-2-carboxamide
Compound characteristics
| Compound ID: | C593-0235 |
| Compound Name: | 4-chloro-N-[(3-chlorophenyl)methyl]thieno[3,2-c]quinoline-2-carboxamide |
| Molecular Weight: | 387.29 |
| Molecular Formula: | C19 H12 Cl2 N2 O S |
| Smiles: | C(c1cccc(c1)[Cl])NC(c1cc2c(nc3ccccc3c2s1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 5.6069 |
| logD: | 5.6068 |
| logSw: | -6.0242 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 34.367 |
| InChI Key: | OIMDSHBNAMPZSD-UHFFFAOYSA-N |