8-methyl-N-[(4-methylphenyl)methyl]-4-oxo-4H-thieno[3,2-c][1]benzopyran-2-carboxamide
Chemical Structure Depiction of
8-methyl-N-[(4-methylphenyl)methyl]-4-oxo-4H-thieno[3,2-c][1]benzopyran-2-carboxamide
8-methyl-N-[(4-methylphenyl)methyl]-4-oxo-4H-thieno[3,2-c][1]benzopyran-2-carboxamide
Compound characteristics
| Compound ID: | C593-1251 |
| Compound Name: | 8-methyl-N-[(4-methylphenyl)methyl]-4-oxo-4H-thieno[3,2-c][1]benzopyran-2-carboxamide |
| Molecular Weight: | 363.43 |
| Molecular Formula: | C21 H17 N O3 S |
| Smiles: | Cc1ccc(CNC(c2cc3C(=O)Oc4ccc(C)cc4c3s2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.7529 |
| logD: | 4.7529 |
| logSw: | -4.5884 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.32 |
| InChI Key: | JNRARZJHPFQQRZ-UHFFFAOYSA-N |