3-methyl-N-{[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl}-N-(propan-2-yl)benzamide
Chemical Structure Depiction of
3-methyl-N-{[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl}-N-(propan-2-yl)benzamide
3-methyl-N-{[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl}-N-(propan-2-yl)benzamide
Compound characteristics
| Compound ID: | C599-0007 |
| Compound Name: | 3-methyl-N-{[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl}-N-(propan-2-yl)benzamide |
| Molecular Weight: | 349.43 |
| Molecular Formula: | C21 H23 N3 O2 |
| Smiles: | CC(C)N(Cc1nc(c2cccc(C)c2)no1)C(c1cccc(C)c1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.936 |
| logD: | 4.936 |
| logSw: | -4.7133 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 47.536 |
| InChI Key: | POMIYAQMDCIZSV-UHFFFAOYSA-N |