N-{[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl}-N-(propan-2-yl)furan-2-carboxamide
Chemical Structure Depiction of
N-{[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl}-N-(propan-2-yl)furan-2-carboxamide
N-{[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl}-N-(propan-2-yl)furan-2-carboxamide
Compound characteristics
| Compound ID: | C599-0213 |
| Compound Name: | N-{[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl}-N-(propan-2-yl)furan-2-carboxamide |
| Molecular Weight: | 325.37 |
| Molecular Formula: | C18 H19 N3 O3 |
| Smiles: | CC(C)N(Cc1nc(c2ccc(C)cc2)no1)C(c1ccco1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9145 |
| logD: | 3.9145 |
| logSw: | -3.9304 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 56.114 |
| InChI Key: | UXHQOEWSNPPRFL-UHFFFAOYSA-N |