3-chloro-4-methyl-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-N-(propan-2-yl)benzamide
Chemical Structure Depiction of
3-chloro-4-methyl-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-N-(propan-2-yl)benzamide
3-chloro-4-methyl-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-N-(propan-2-yl)benzamide
Compound characteristics
| Compound ID: | C599-0271 |
| Compound Name: | 3-chloro-4-methyl-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-N-(propan-2-yl)benzamide |
| Molecular Weight: | 369.85 |
| Molecular Formula: | C20 H20 Cl N3 O2 |
| Smiles: | CC(C)N(Cc1nc(c2ccccc2)no1)C(c1ccc(C)c(c1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 5.2906 |
| logD: | 5.2906 |
| logSw: | -5.909 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 47.536 |
| InChI Key: | PSUZGTFTJQJTFY-UHFFFAOYSA-N |