3-(2-chlorophenyl)-5-methyl-N-{[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl}-N-(propan-2-yl)-1,2-oxazole-4-carboxamide
Chemical Structure Depiction of
3-(2-chlorophenyl)-5-methyl-N-{[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl}-N-(propan-2-yl)-1,2-oxazole-4-carboxamide
3-(2-chlorophenyl)-5-methyl-N-{[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl}-N-(propan-2-yl)-1,2-oxazole-4-carboxamide
Compound characteristics
| Compound ID: | C599-0428 |
| Compound Name: | 3-(2-chlorophenyl)-5-methyl-N-{[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl}-N-(propan-2-yl)-1,2-oxazole-4-carboxamide |
| Molecular Weight: | 450.92 |
| Molecular Formula: | C24 H23 Cl N4 O3 |
| Smiles: | CC(C)N(Cc1nc(c2ccc(C)cc2)no1)C(c1c(c2ccccc2[Cl])noc1C)=O |
| Stereo: | ACHIRAL |
| logP: | 5.4825 |
| logD: | 5.4825 |
| logSw: | -5.955 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 69.496 |
| InChI Key: | GDOXCKFZNIBNAB-UHFFFAOYSA-N |