2-(3-chlorophenoxy)-N-{[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl}-N-(propan-2-yl)propanamide
Chemical Structure Depiction of
2-(3-chlorophenoxy)-N-{[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl}-N-(propan-2-yl)propanamide
2-(3-chlorophenoxy)-N-{[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl}-N-(propan-2-yl)propanamide
Compound characteristics
| Compound ID: | C599-0525 |
| Compound Name: | 2-(3-chlorophenoxy)-N-{[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl}-N-(propan-2-yl)propanamide |
| Molecular Weight: | 429.9 |
| Molecular Formula: | C22 H24 Cl N3 O4 |
| Smiles: | CC(C)N(Cc1nc(c2ccc(cc2)OC)no1)C(C(C)Oc1cccc(c1)[Cl])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.2988 |
| logD: | 5.2988 |
| logSw: | -5.9419 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 61.869 |
| InChI Key: | BJSNQQVXOYHYFN-HNNXBMFYSA-N |