ethyl [2-oxo-6-{4-[3-(trifluoromethyl)phenyl]piperazine-1-sulfonyl}-1,3-benzoxazol-3(2H)-yl]acetate
Chemical Structure Depiction of
ethyl [2-oxo-6-{4-[3-(trifluoromethyl)phenyl]piperazine-1-sulfonyl}-1,3-benzoxazol-3(2H)-yl]acetate
ethyl [2-oxo-6-{4-[3-(trifluoromethyl)phenyl]piperazine-1-sulfonyl}-1,3-benzoxazol-3(2H)-yl]acetate
Compound characteristics
| Compound ID: | C602-0154 |
| Compound Name: | ethyl [2-oxo-6-{4-[3-(trifluoromethyl)phenyl]piperazine-1-sulfonyl}-1,3-benzoxazol-3(2H)-yl]acetate |
| Molecular Weight: | 513.49 |
| Molecular Formula: | C22 H22 F3 N3 O6 S |
| Smiles: | CCOC(CN1C(=O)Oc2cc(ccc12)S(N1CCN(CC1)c1cccc(c1)C(F)(F)F)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3783 |
| logD: | 3.3783 |
| logSw: | -3.9777 |
| Hydrogen bond acceptors count: | 11 |
| Polar surface area: | 78.469 |
| InChI Key: | NBQJGQMLRWCNSX-UHFFFAOYSA-N |