N~1~-{1-[4-(4-fluorophenyl)piperazin-1-yl]-1-(thiophen-2-yl)propan-2-yl}-N~2~-[2-(4-methoxyphenyl)ethyl]ethanediamide
Chemical Structure Depiction of
N~1~-{1-[4-(4-fluorophenyl)piperazin-1-yl]-1-(thiophen-2-yl)propan-2-yl}-N~2~-[2-(4-methoxyphenyl)ethyl]ethanediamide
N~1~-{1-[4-(4-fluorophenyl)piperazin-1-yl]-1-(thiophen-2-yl)propan-2-yl}-N~2~-[2-(4-methoxyphenyl)ethyl]ethanediamide
Compound characteristics
| Compound ID: | C609-0332 |
| Compound Name: | N~1~-{1-[4-(4-fluorophenyl)piperazin-1-yl]-1-(thiophen-2-yl)propan-2-yl}-N~2~-[2-(4-methoxyphenyl)ethyl]ethanediamide |
| Molecular Weight: | 524.66 |
| Molecular Formula: | C28 H33 F N4 O3 S |
| Smiles: | CC(C(c1cccs1)N1CCN(CC1)c1ccc(cc1)F)NC(C(NCCc1ccc(cc1)OC)=O)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 3.6107 |
| logD: | 3.5961 |
| logSw: | -3.8675 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 63.189 |
| InChI Key: | LMVQWPZZPWVLAI-UHFFFAOYSA-N |