methyl 3-amino-6-ethyl-5,6,7,8-tetrahydrothieno[2,3-b][1,6]naphthyridine-2-carboxylate
Chemical Structure Depiction of
methyl 3-amino-6-ethyl-5,6,7,8-tetrahydrothieno[2,3-b][1,6]naphthyridine-2-carboxylate
methyl 3-amino-6-ethyl-5,6,7,8-tetrahydrothieno[2,3-b][1,6]naphthyridine-2-carboxylate
Compound characteristics
| Compound ID: | C611-0684 |
| Compound Name: | methyl 3-amino-6-ethyl-5,6,7,8-tetrahydrothieno[2,3-b][1,6]naphthyridine-2-carboxylate |
| Molecular Weight: | 291.37 |
| Molecular Formula: | C14 H17 N3 O2 S |
| Smiles: | CCN1CCc2c(C1)cc1c(c(C(=O)OC)sc1n2)N |
| Stereo: | ACHIRAL |
| logP: | 2.1607 |
| logD: | 2.0012 |
| logSw: | -2.3092 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 55.41 |
| InChI Key: | WMVVCBTYIDSAQY-UHFFFAOYSA-N |