4-chloro-N-(5-chloro-2-methylphenyl)-N,8-dimethylthieno[3,2-c]quinoline-2-carboxamide
Chemical Structure Depiction of
4-chloro-N-(5-chloro-2-methylphenyl)-N,8-dimethylthieno[3,2-c]quinoline-2-carboxamide
4-chloro-N-(5-chloro-2-methylphenyl)-N,8-dimethylthieno[3,2-c]quinoline-2-carboxamide
Compound characteristics
| Compound ID: | C618-0120 |
| Compound Name: | 4-chloro-N-(5-chloro-2-methylphenyl)-N,8-dimethylthieno[3,2-c]quinoline-2-carboxamide |
| Molecular Weight: | 415.34 |
| Molecular Formula: | C21 H16 Cl2 N2 O S |
| Smiles: | Cc1ccc2c(c1)c1c(cc(C(N(C)c3cc(ccc3C)[Cl])=O)s1)c(n2)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 6.8144 |
| logD: | 6.8144 |
| logSw: | -6.3723 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 25.0215 |
| InChI Key: | VZUDLYULJAIYMD-UHFFFAOYSA-N |