1-[2-(4-ethylpiperazin-1-yl)-2-oxoethyl]-8-methyl[1]benzopyrano[4,3-c]pyrazol-4(1H)-one
Chemical Structure Depiction of
1-[2-(4-ethylpiperazin-1-yl)-2-oxoethyl]-8-methyl[1]benzopyrano[4,3-c]pyrazol-4(1H)-one
1-[2-(4-ethylpiperazin-1-yl)-2-oxoethyl]-8-methyl[1]benzopyrano[4,3-c]pyrazol-4(1H)-one
Compound characteristics
| Compound ID: | C618-0686 |
| Compound Name: | 1-[2-(4-ethylpiperazin-1-yl)-2-oxoethyl]-8-methyl[1]benzopyrano[4,3-c]pyrazol-4(1H)-one |
| Molecular Weight: | 354.41 |
| Molecular Formula: | C19 H22 N4 O3 |
| Smiles: | CCN1CCN(CC1)C(Cn1c2c3cc(C)ccc3OC(c2cn1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.3449 |
| logD: | 1.1687 |
| logSw: | -2.2445 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 54.388 |
| InChI Key: | SGRUQSFPMJOALT-UHFFFAOYSA-N |