5-(cyclohexylamino)-3-(4-phenylpiperazin-1-yl)-6H-anthra[1,9-cd][1,2]oxazol-6-one
Chemical Structure Depiction of
5-(cyclohexylamino)-3-(4-phenylpiperazin-1-yl)-6H-anthra[1,9-cd][1,2]oxazol-6-one
5-(cyclohexylamino)-3-(4-phenylpiperazin-1-yl)-6H-anthra[1,9-cd][1,2]oxazol-6-one
Compound characteristics
| Compound ID: | C620-0237 |
| Compound Name: | 5-(cyclohexylamino)-3-(4-phenylpiperazin-1-yl)-6H-anthra[1,9-cd][1,2]oxazol-6-one |
| Molecular Weight: | 478.59 |
| Molecular Formula: | C30 H30 N4 O2 |
| Smiles: | C1CCC(CC1)Nc1cc(c2c3c1C(c1ccccc1c3on2)=O)N1CCN(CC1)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 7.1763 |
| logD: | 7.1763 |
| logSw: | -6.2998 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.855 |
| InChI Key: | TYANZDHSCDSDIP-UHFFFAOYSA-N |