5-(cyclohexylamino)-3-(4-propylpiperazin-1-yl)-6H-anthra[1,9-cd][1,2]oxazol-6-one
Chemical Structure Depiction of
5-(cyclohexylamino)-3-(4-propylpiperazin-1-yl)-6H-anthra[1,9-cd][1,2]oxazol-6-one
5-(cyclohexylamino)-3-(4-propylpiperazin-1-yl)-6H-anthra[1,9-cd][1,2]oxazol-6-one
Compound characteristics
| Compound ID: | C620-0258 |
| Compound Name: | 5-(cyclohexylamino)-3-(4-propylpiperazin-1-yl)-6H-anthra[1,9-cd][1,2]oxazol-6-one |
| Molecular Weight: | 444.58 |
| Molecular Formula: | C27 H32 N4 O2 |
| Smiles: | CCCN1CCN(CC1)c1cc(c2C(c3ccccc3c3c2c1no3)=O)NC1CCCCC1 |
| Stereo: | ACHIRAL |
| logP: | 6.1713 |
| logD: | 5.7402 |
| logSw: | -5.7601 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.385 |
| InChI Key: | JXOOZQDTIVQGDV-UHFFFAOYSA-N |