4-chloro-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-methyl-1,2-oxazole-5-carboxamide
Chemical Structure Depiction of
4-chloro-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-methyl-1,2-oxazole-5-carboxamide
4-chloro-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-methyl-1,2-oxazole-5-carboxamide
Compound characteristics
| Compound ID: | C625-0180 |
| Compound Name: | 4-chloro-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-methyl-1,2-oxazole-5-carboxamide |
| Molecular Weight: | 324.76 |
| Molecular Formula: | C15 H17 Cl N2 O4 |
| Smiles: | Cc1c(c(C(NCCc2ccc(c(c2)OC)OC)=O)on1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 1.8762 |
| logD: | 1.8762 |
| logSw: | -3.309 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.371 |
| InChI Key: | MIOXXIPJRFERAX-UHFFFAOYSA-N |