N-(3-chlorophenyl)-N,4-dimethylfuro[3,2-c]quinoline-2-carboxamide
Chemical Structure Depiction of
N-(3-chlorophenyl)-N,4-dimethylfuro[3,2-c]quinoline-2-carboxamide
N-(3-chlorophenyl)-N,4-dimethylfuro[3,2-c]quinoline-2-carboxamide
Compound characteristics
| Compound ID: | C629-0139 |
| Compound Name: | N-(3-chlorophenyl)-N,4-dimethylfuro[3,2-c]quinoline-2-carboxamide |
| Molecular Weight: | 350.8 |
| Molecular Formula: | C20 H15 Cl N2 O2 |
| Smiles: | Cc1c2cc(C(N(C)c3cccc(c3)[Cl])=O)oc2c2ccccc2n1 |
| Stereo: | ACHIRAL |
| logP: | 4.6092 |
| logD: | 4.6089 |
| logSw: | -4.6877 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 33.041 |
| InChI Key: | MDHYDAABUWWKLV-UHFFFAOYSA-N |