1-(2,4-dimethylphenyl)-4-{1-[2-(4-methylphenoxy)ethyl]-1H-benzimidazol-2-yl}pyrrolidin-2-one
Chemical Structure Depiction of
1-(2,4-dimethylphenyl)-4-{1-[2-(4-methylphenoxy)ethyl]-1H-benzimidazol-2-yl}pyrrolidin-2-one
1-(2,4-dimethylphenyl)-4-{1-[2-(4-methylphenoxy)ethyl]-1H-benzimidazol-2-yl}pyrrolidin-2-one
Compound characteristics
| Compound ID: | C630-0019 |
| Compound Name: | 1-(2,4-dimethylphenyl)-4-{1-[2-(4-methylphenoxy)ethyl]-1H-benzimidazol-2-yl}pyrrolidin-2-one |
| Molecular Weight: | 439.56 |
| Molecular Formula: | C28 H29 N3 O2 |
| Smiles: | Cc1ccc(cc1)OCCn1c2ccccc2nc1C1CC(N(C1)c1ccc(C)cc1C)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.4866 |
| logD: | 6.4865 |
| logSw: | -5.5094 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 33.741 |
| InChI Key: | DIZGOWSWFLZVSL-JOCHJYFZSA-N |