2-[2-(3,4-dimethylbenzene-1-sulfonyl)hydrazinylidene]-N-(4-methylphenyl)-2H-1-benzopyran-3-carboxamide
Chemical Structure Depiction of
2-[2-(3,4-dimethylbenzene-1-sulfonyl)hydrazinylidene]-N-(4-methylphenyl)-2H-1-benzopyran-3-carboxamide
2-[2-(3,4-dimethylbenzene-1-sulfonyl)hydrazinylidene]-N-(4-methylphenyl)-2H-1-benzopyran-3-carboxamide
Compound characteristics
| Compound ID: | C635-0027 |
| Compound Name: | 2-[2-(3,4-dimethylbenzene-1-sulfonyl)hydrazinylidene]-N-(4-methylphenyl)-2H-1-benzopyran-3-carboxamide |
| Molecular Weight: | 461.54 |
| Molecular Formula: | C25 H23 N3 O4 S |
| Smiles: | Cc1ccc(cc1)NC(C1=Cc2ccccc2OC/1=N/NS(c1ccc(C)c(C)c1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.283 |
| logD: | 2.0285 |
| logSw: | -5.1633 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 81.457 |
| InChI Key: | NACVBJCEVGLDFC-UHFFFAOYSA-N |