2-{3-[2-(cyclohex-1-en-1-yl)ethyl]-1-(4-fluorophenyl)-2,5-dioxoimidazolidin-4-yl}-N-(4-propoxyphenyl)acetamide
Chemical Structure Depiction of
2-{3-[2-(cyclohex-1-en-1-yl)ethyl]-1-(4-fluorophenyl)-2,5-dioxoimidazolidin-4-yl}-N-(4-propoxyphenyl)acetamide
2-{3-[2-(cyclohex-1-en-1-yl)ethyl]-1-(4-fluorophenyl)-2,5-dioxoimidazolidin-4-yl}-N-(4-propoxyphenyl)acetamide
Compound characteristics
| Compound ID: | C636-2419 |
| Compound Name: | 2-{3-[2-(cyclohex-1-en-1-yl)ethyl]-1-(4-fluorophenyl)-2,5-dioxoimidazolidin-4-yl}-N-(4-propoxyphenyl)acetamide |
| Molecular Weight: | 493.58 |
| Molecular Formula: | C28 H32 F N3 O4 |
| Smiles: | CCCOc1ccc(cc1)NC(CC1C(N(C(N1CCC1CCCCC=1)=O)c1ccc(cc1)F)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.0321 |
| logD: | 5.0321 |
| logSw: | -4.3922 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.293 |
| InChI Key: | YNXMOFLAXQRCQC-RUZDIDTESA-N |