3-(3-methoxyphenyl)-N-(pyridin-3-yl)-4,5-dihydro-1,2-oxazole-5-carboxamide
Chemical Structure Depiction of
3-(3-methoxyphenyl)-N-(pyridin-3-yl)-4,5-dihydro-1,2-oxazole-5-carboxamide
3-(3-methoxyphenyl)-N-(pyridin-3-yl)-4,5-dihydro-1,2-oxazole-5-carboxamide
Compound characteristics
| Compound ID: | C651-0110 |
| Compound Name: | 3-(3-methoxyphenyl)-N-(pyridin-3-yl)-4,5-dihydro-1,2-oxazole-5-carboxamide |
| Molecular Weight: | 297.31 |
| Molecular Formula: | C16 H15 N3 O3 |
| Smiles: | COc1cccc(c1)C1CC(C(Nc2cccnc2)=O)ON=1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.1539 |
| logD: | 2.1538 |
| logSw: | -2.4655 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.985 |
| InChI Key: | OAYLZJHVKRLXBQ-HNNXBMFYSA-N |