3-(2-methoxyphenyl)-N-[3-(morpholin-4-yl)propyl]-4,5-dihydro-1,2-oxazole-5-carboxamide
Chemical Structure Depiction of
3-(2-methoxyphenyl)-N-[3-(morpholin-4-yl)propyl]-4,5-dihydro-1,2-oxazole-5-carboxamide
3-(2-methoxyphenyl)-N-[3-(morpholin-4-yl)propyl]-4,5-dihydro-1,2-oxazole-5-carboxamide
Compound characteristics
| Compound ID: | C651-0205 |
| Compound Name: | 3-(2-methoxyphenyl)-N-[3-(morpholin-4-yl)propyl]-4,5-dihydro-1,2-oxazole-5-carboxamide |
| Molecular Weight: | 347.41 |
| Molecular Formula: | C18 H25 N3 O4 |
| Smiles: | COc1ccccc1C1CC(C(NCCCN2CCOCC2)=O)ON=1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 0.8905 |
| logD: | 0.4669 |
| logSw: | -1.9957 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.608 |
| InChI Key: | PTIHRFVWLLYBSZ-KRWDZBQOSA-N |