N-(2,4-difluorophenyl)-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide
Chemical Structure Depiction of
N-(2,4-difluorophenyl)-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide
N-(2,4-difluorophenyl)-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide
Compound characteristics
| Compound ID: | C651-0277 |
| Compound Name: | N-(2,4-difluorophenyl)-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide |
| Molecular Weight: | 320.27 |
| Molecular Formula: | C16 H11 F3 N2 O2 |
| Smiles: | C1C(C(Nc2ccc(cc2F)F)=O)ON=C1c1ccc(cc1)F |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.4376 |
| logD: | 3.3887 |
| logSw: | -3.6914 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.225 |
| InChI Key: | YJHNSBFMFSBLOL-HNNXBMFYSA-N |