3-(2-fluorophenyl)-N-[2-(methylsulfanyl)phenyl]-4,5-dihydro-1,2-oxazole-5-carboxamide
Chemical Structure Depiction of
3-(2-fluorophenyl)-N-[2-(methylsulfanyl)phenyl]-4,5-dihydro-1,2-oxazole-5-carboxamide
3-(2-fluorophenyl)-N-[2-(methylsulfanyl)phenyl]-4,5-dihydro-1,2-oxazole-5-carboxamide
Compound characteristics
| Compound ID: | C651-0353 |
| Compound Name: | 3-(2-fluorophenyl)-N-[2-(methylsulfanyl)phenyl]-4,5-dihydro-1,2-oxazole-5-carboxamide |
| Molecular Weight: | 330.38 |
| Molecular Formula: | C17 H15 F N2 O2 S |
| Smiles: | CSc1ccccc1NC(C1CC(c2ccccc2F)=NO1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.4698 |
| logD: | 3.4698 |
| logSw: | -3.8568 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.225 |
| InChI Key: | CQBVFOSBWRHLMH-HNNXBMFYSA-N |