N-(2,4-difluorophenyl)-3-(2,5-dimethoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide
Chemical Structure Depiction of
N-(2,4-difluorophenyl)-3-(2,5-dimethoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide
N-(2,4-difluorophenyl)-3-(2,5-dimethoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide
Compound characteristics
| Compound ID: | C651-0613 |
| Compound Name: | N-(2,4-difluorophenyl)-3-(2,5-dimethoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide |
| Molecular Weight: | 362.33 |
| Molecular Formula: | C18 H16 F2 N2 O4 |
| Smiles: | COc1ccc(c(c1)C1CC(C(Nc2ccc(cc2F)F)=O)ON=1)OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.2859 |
| logD: | 3.237 |
| logSw: | -3.6615 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.4 |
| InChI Key: | QMPPONKQXMCEQA-KRWDZBQOSA-N |