[3-(2,5-dimethoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl](pyrrolidin-1-yl)methanone
					Chemical Structure Depiction of
[3-(2,5-dimethoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl](pyrrolidin-1-yl)methanone
			[3-(2,5-dimethoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl](pyrrolidin-1-yl)methanone
Compound characteristics
| Compound ID: | C651-0646 | 
| Compound Name: | [3-(2,5-dimethoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl](pyrrolidin-1-yl)methanone | 
| Molecular Weight: | 304.34 | 
| Molecular Formula: | C16 H20 N2 O4 | 
| Smiles: | COc1ccc(c(c1)C1CC(C(N2CCCC2)=O)ON=1)OC | 
| Stereo: | RACEMIC MIXTURE | 
| logP: | 2.2079 | 
| logD: | 2.2079 | 
| logSw: | -2.855 | 
| Hydrogen bond acceptors count: | 6 | 
| Polar surface area: | 55.02 | 
| InChI Key: | GAHJHENZUWMRBG-HNNXBMFYSA-N | 
 
				 
				