N-[(pyridin-2-yl)methyl]-3-(3,4,5-trimethoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide
Chemical Structure Depiction of
N-[(pyridin-2-yl)methyl]-3-(3,4,5-trimethoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide
N-[(pyridin-2-yl)methyl]-3-(3,4,5-trimethoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide
Compound characteristics
| Compound ID: | C651-0752 |
| Compound Name: | N-[(pyridin-2-yl)methyl]-3-(3,4,5-trimethoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide |
| Molecular Weight: | 371.39 |
| Molecular Formula: | C19 H21 N3 O5 |
| Smiles: | COc1cc(cc(c1OC)OC)C1CC(C(NCc2ccccn2)=O)ON=1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.4335 |
| logD: | 1.4332 |
| logSw: | -2.0446 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 79.766 |
| InChI Key: | AZJVHDLLIIYXSZ-KRWDZBQOSA-N |