ethyl 4-(2-ethoxyphenyl)-6-[(4-fluorobenzene-1-sulfonyl)methyl]-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate
Chemical Structure Depiction of
ethyl 4-(2-ethoxyphenyl)-6-[(4-fluorobenzene-1-sulfonyl)methyl]-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate
ethyl 4-(2-ethoxyphenyl)-6-[(4-fluorobenzene-1-sulfonyl)methyl]-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate
Compound characteristics
| Compound ID: | C653-0193 |
| Compound Name: | ethyl 4-(2-ethoxyphenyl)-6-[(4-fluorobenzene-1-sulfonyl)methyl]-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
| Molecular Weight: | 462.5 |
| Molecular Formula: | C22 H23 F N2 O6 S |
| Smiles: | CCOC(C1C(c2ccccc2OCC)NC(NC=1CS(c1ccc(cc1)F)(=O)=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.9965 |
| logD: | 2.5708 |
| logSw: | -3.4961 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 93.027 |
| InChI Key: | GWHJSZJOGXDAGY-HXUWFJFHSA-N |