2-[3-(4-chlorobenzene-1-sulfonyl)-6-methoxy-4-oxoquinolin-1(4H)-yl]-N-phenylacetamide
Chemical Structure Depiction of
2-[3-(4-chlorobenzene-1-sulfonyl)-6-methoxy-4-oxoquinolin-1(4H)-yl]-N-phenylacetamide
2-[3-(4-chlorobenzene-1-sulfonyl)-6-methoxy-4-oxoquinolin-1(4H)-yl]-N-phenylacetamide
Compound characteristics
| Compound ID: | C655-0027 |
| Compound Name: | 2-[3-(4-chlorobenzene-1-sulfonyl)-6-methoxy-4-oxoquinolin-1(4H)-yl]-N-phenylacetamide |
| Molecular Weight: | 482.94 |
| Molecular Formula: | C24 H19 Cl N2 O5 S |
| Smiles: | COc1ccc2c(c1)C(C(=CN2CC(Nc1ccccc1)=O)S(c1ccc(cc1)[Cl])(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9923 |
| logD: | 3.9923 |
| logSw: | -4.6146 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 75.756 |
| InChI Key: | CNQZEUKTZZPJCU-UHFFFAOYSA-N |