2-[3-(benzenesulfonyl)-4-oxoquinolin-1(4H)-yl]-N-(4-ethylphenyl)acetamide
Chemical Structure Depiction of
2-[3-(benzenesulfonyl)-4-oxoquinolin-1(4H)-yl]-N-(4-ethylphenyl)acetamide
2-[3-(benzenesulfonyl)-4-oxoquinolin-1(4H)-yl]-N-(4-ethylphenyl)acetamide
Compound characteristics
| Compound ID: | C655-0209 |
| Compound Name: | 2-[3-(benzenesulfonyl)-4-oxoquinolin-1(4H)-yl]-N-(4-ethylphenyl)acetamide |
| Molecular Weight: | 446.52 |
| Molecular Formula: | C25 H22 N2 O4 S |
| Smiles: | CCc1ccc(cc1)NC(CN1C=C(C(c2ccccc12)=O)S(c1ccccc1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2694 |
| logD: | 4.2694 |
| logSw: | -4.27 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 68.213 |
| InChI Key: | LYEKEXCXEJAPAS-UHFFFAOYSA-N |