N-[3-(4-phenylpiperazin-1-yl)propyl]-4H-thieno[3,2-c][1]benzopyran-2-carboxamide
Chemical Structure Depiction of
N-[3-(4-phenylpiperazin-1-yl)propyl]-4H-thieno[3,2-c][1]benzopyran-2-carboxamide
N-[3-(4-phenylpiperazin-1-yl)propyl]-4H-thieno[3,2-c][1]benzopyran-2-carboxamide
Compound characteristics
| Compound ID: | C660-0300 |
| Compound Name: | N-[3-(4-phenylpiperazin-1-yl)propyl]-4H-thieno[3,2-c][1]benzopyran-2-carboxamide |
| Molecular Weight: | 433.57 |
| Molecular Formula: | C25 H27 N3 O2 S |
| Smiles: | C(CNC(c1cc2COc3ccccc3c2s1)=O)CN1CCN(CC1)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 3.8838 |
| logD: | 3.34 |
| logSw: | -3.97 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.853 |
| InChI Key: | SYFHXKUERBFRAL-UHFFFAOYSA-N |