3-(4-chlorophenyl)-N-[2-(4-chlorophenyl)ethyl][1,2]oxazolo[5,4-d]pyrimidin-4-amine
Chemical Structure Depiction of
3-(4-chlorophenyl)-N-[2-(4-chlorophenyl)ethyl][1,2]oxazolo[5,4-d]pyrimidin-4-amine
3-(4-chlorophenyl)-N-[2-(4-chlorophenyl)ethyl][1,2]oxazolo[5,4-d]pyrimidin-4-amine
Compound characteristics
| Compound ID: | C660-0620 |
| Compound Name: | 3-(4-chlorophenyl)-N-[2-(4-chlorophenyl)ethyl][1,2]oxazolo[5,4-d]pyrimidin-4-amine |
| Molecular Weight: | 385.25 |
| Molecular Formula: | C19 H14 Cl2 N4 O |
| Smiles: | C(CNc1c2c(c3ccc(cc3)[Cl])noc2ncn1)c1ccc(cc1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 5.0261 |
| logD: | 5.0261 |
| logSw: | -5.4787 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.865 |
| InChI Key: | FUYQBUHXHRCAAA-UHFFFAOYSA-N |