1'-[3-(4-chlorophenyl)[1,2]oxazolo[5,4-d]pyrimidin-4-yl]-1,4'-bipiperidine
Chemical Structure Depiction of
1'-[3-(4-chlorophenyl)[1,2]oxazolo[5,4-d]pyrimidin-4-yl]-1,4'-bipiperidine
1'-[3-(4-chlorophenyl)[1,2]oxazolo[5,4-d]pyrimidin-4-yl]-1,4'-bipiperidine
Compound characteristics
| Compound ID: | C660-0696 |
| Compound Name: | 1'-[3-(4-chlorophenyl)[1,2]oxazolo[5,4-d]pyrimidin-4-yl]-1,4'-bipiperidine |
| Molecular Weight: | 397.91 |
| Molecular Formula: | C21 H24 Cl N5 O |
| Smiles: | C1CCN(CC1)C1CCN(CC1)c1c2c(c3ccc(cc3)[Cl])noc2ncn1 |
| Stereo: | ACHIRAL |
| logP: | 4.5505 |
| logD: | 1.9914 |
| logSw: | -4.9288 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 48.628 |
| InChI Key: | QKFAWYQUSAGDQK-UHFFFAOYSA-N |