2-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]-N-{[4-(methylsulfanyl)phenyl]methyl}quinazolin-4-amine
Chemical Structure Depiction of
2-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]-N-{[4-(methylsulfanyl)phenyl]methyl}quinazolin-4-amine
2-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]-N-{[4-(methylsulfanyl)phenyl]methyl}quinazolin-4-amine
Compound characteristics
| Compound ID: | C660-1571 |
| Compound Name: | 2-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]-N-{[4-(methylsulfanyl)phenyl]methyl}quinazolin-4-amine |
| Molecular Weight: | 439.54 |
| Molecular Formula: | C25 H21 N5 O S |
| Smiles: | Cc1ccc(cc1)c1nnc(c2nc(c3ccccc3n2)NCc2ccc(cc2)SC)o1 |
| Stereo: | ACHIRAL |
| logP: | 5.8861 |
| logD: | 5.8861 |
| logSw: | -5.8912 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.643 |
| InChI Key: | DRQFABZUIORYDS-UHFFFAOYSA-N |