7-chloro-N-[(thiophen-2-yl)methyl]-3-[3-(trifluoromethyl)phenyl][1,2,3]triazolo[1,5-a]quinazolin-5-amine
Chemical Structure Depiction of
7-chloro-N-[(thiophen-2-yl)methyl]-3-[3-(trifluoromethyl)phenyl][1,2,3]triazolo[1,5-a]quinazolin-5-amine
7-chloro-N-[(thiophen-2-yl)methyl]-3-[3-(trifluoromethyl)phenyl][1,2,3]triazolo[1,5-a]quinazolin-5-amine
Compound characteristics
| Compound ID: | C680-0797 |
| Compound Name: | 7-chloro-N-[(thiophen-2-yl)methyl]-3-[3-(trifluoromethyl)phenyl][1,2,3]triazolo[1,5-a]quinazolin-5-amine |
| Molecular Weight: | 459.88 |
| Molecular Formula: | C21 H13 Cl F3 N5 S |
| Smiles: | C(c1cccs1)Nc1c2cc(ccc2n2c(c(c3cccc(c3)C(F)(F)F)nn2)n1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 6.0793 |
| logD: | 6.0791 |
| logSw: | -6.6618 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.088 |
| InChI Key: | CXLDFAFEDYORRJ-UHFFFAOYSA-N |