3-(4-ethylbenzene-1-sulfonyl)-1-[(3-fluorophenyl)methyl]-6,7-dimethoxyquinolin-4(1H)-one
Chemical Structure Depiction of
3-(4-ethylbenzene-1-sulfonyl)-1-[(3-fluorophenyl)methyl]-6,7-dimethoxyquinolin-4(1H)-one
3-(4-ethylbenzene-1-sulfonyl)-1-[(3-fluorophenyl)methyl]-6,7-dimethoxyquinolin-4(1H)-one
Compound characteristics
| Compound ID: | C682-1263 |
| Compound Name: | 3-(4-ethylbenzene-1-sulfonyl)-1-[(3-fluorophenyl)methyl]-6,7-dimethoxyquinolin-4(1H)-one |
| Molecular Weight: | 481.54 |
| Molecular Formula: | C26 H24 F N O5 S |
| Smiles: | CCc1ccc(cc1)S(C1=CN(Cc2cccc(c2)F)c2cc(c(cc2C1=O)OC)OC)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7036 |
| logD: | 4.7036 |
| logSw: | -4.5861 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 60.324 |
| InChI Key: | YGAMVIWBRNELMB-UHFFFAOYSA-N |