1-ethyl-3-(4-ethylbenzene-1-sulfonyl)quinolin-4(1H)-one
Chemical Structure Depiction of
1-ethyl-3-(4-ethylbenzene-1-sulfonyl)quinolin-4(1H)-one
1-ethyl-3-(4-ethylbenzene-1-sulfonyl)quinolin-4(1H)-one
Compound characteristics
| Compound ID: | C682-1500 |
| Compound Name: | 1-ethyl-3-(4-ethylbenzene-1-sulfonyl)quinolin-4(1H)-one |
| Molecular Weight: | 341.43 |
| Molecular Formula: | C19 H19 N O3 S |
| Smiles: | CCc1ccc(cc1)S(C1=CN(CC)c2ccccc2C1=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6515 |
| logD: | 3.6515 |
| logSw: | -3.9599 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 45.06 |
| InChI Key: | BVTZMUKTHPESSA-UHFFFAOYSA-N |