9-ethoxy-2-(4-methoxyphenyl)-4-(methylsulfanyl)-5H-[1]benzopyrano[2,3-d]pyrimidine
Chemical Structure Depiction of
9-ethoxy-2-(4-methoxyphenyl)-4-(methylsulfanyl)-5H-[1]benzopyrano[2,3-d]pyrimidine
9-ethoxy-2-(4-methoxyphenyl)-4-(methylsulfanyl)-5H-[1]benzopyrano[2,3-d]pyrimidine
Compound characteristics
| Compound ID: | C683-0316 |
| Compound Name: | 9-ethoxy-2-(4-methoxyphenyl)-4-(methylsulfanyl)-5H-[1]benzopyrano[2,3-d]pyrimidine |
| Molecular Weight: | 380.46 |
| Molecular Formula: | C21 H20 N2 O3 S |
| Smiles: | CCOc1cccc2Cc3c(nc(c4ccc(cc4)OC)nc3SC)Oc12 |
| Stereo: | ACHIRAL |
| logP: | 6.1689 |
| logD: | 6.1659 |
| logSw: | -5.7771 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 40.84 |
| InChI Key: | OQAALZKBJSYYNG-UHFFFAOYSA-N |