3-[2-(4-fluorophenyl)acetamido]-N-(4-methoxyphenyl)-1-benzofuran-2-carboxamide
Chemical Structure Depiction of
3-[2-(4-fluorophenyl)acetamido]-N-(4-methoxyphenyl)-1-benzofuran-2-carboxamide
3-[2-(4-fluorophenyl)acetamido]-N-(4-methoxyphenyl)-1-benzofuran-2-carboxamide
Compound characteristics
| Compound ID: | C686-0444 |
| Compound Name: | 3-[2-(4-fluorophenyl)acetamido]-N-(4-methoxyphenyl)-1-benzofuran-2-carboxamide |
| Molecular Weight: | 418.42 |
| Molecular Formula: | C24 H19 F N2 O4 |
| Smiles: | COc1ccc(cc1)NC(c1c(c2ccccc2o1)NC(Cc1ccc(cc1)F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2708 |
| logD: | 4.2682 |
| logSw: | -4.3911 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 60.881 |
| InChI Key: | RUNPJCXOZNRMLV-UHFFFAOYSA-N |