N-(3-fluorophenyl)-3-[(tricyclo[3.3.1.1~3,7~]decane-1-carbonyl)amino]-1-benzofuran-2-carboxamide
Chemical Structure Depiction of
N-(3-fluorophenyl)-3-[(tricyclo[3.3.1.1~3,7~]decane-1-carbonyl)amino]-1-benzofuran-2-carboxamide
N-(3-fluorophenyl)-3-[(tricyclo[3.3.1.1~3,7~]decane-1-carbonyl)amino]-1-benzofuran-2-carboxamide
Compound characteristics
| Compound ID: | C686-0610 |
| Compound Name: | N-(3-fluorophenyl)-3-[(tricyclo[3.3.1.1~3,7~]decane-1-carbonyl)amino]-1-benzofuran-2-carboxamide |
| Molecular Weight: | 432.49 |
| Molecular Formula: | C26 H25 F N2 O3 |
| Smiles: | C1C2CC3CC1CC(C2)(C3)C(Nc1c2ccccc2oc1C(Nc1cccc(c1)F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 6.0728 |
| logD: | 6.0654 |
| logSw: | -6.3181 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 53.584 |
| InChI Key: | XLPZFLXDEIXISR-UHFFFAOYSA-N |