3-(2,4-dimethoxybenzamido)-N-(4-ethoxyphenyl)-1-benzofuran-2-carboxamide
Chemical Structure Depiction of
3-(2,4-dimethoxybenzamido)-N-(4-ethoxyphenyl)-1-benzofuran-2-carboxamide
3-(2,4-dimethoxybenzamido)-N-(4-ethoxyphenyl)-1-benzofuran-2-carboxamide
Compound characteristics
| Compound ID: | C686-0868 |
| Compound Name: | 3-(2,4-dimethoxybenzamido)-N-(4-ethoxyphenyl)-1-benzofuran-2-carboxamide |
| Molecular Weight: | 460.49 |
| Molecular Formula: | C26 H24 N2 O6 |
| Smiles: | CCOc1ccc(cc1)NC(c1c(c2ccccc2o1)NC(c1ccc(cc1OC)OC)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6266 |
| logD: | 4.4714 |
| logSw: | -4.3443 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 75.849 |
| InChI Key: | LLIYKTCGVGKWSX-UHFFFAOYSA-N |