N-(4-ethoxyphenyl)-3-[2-(3-methylphenyl)acetamido]-1-benzofuran-2-carboxamide
Chemical Structure Depiction of
N-(4-ethoxyphenyl)-3-[2-(3-methylphenyl)acetamido]-1-benzofuran-2-carboxamide
N-(4-ethoxyphenyl)-3-[2-(3-methylphenyl)acetamido]-1-benzofuran-2-carboxamide
Compound characteristics
| Compound ID: | C686-0919 |
| Compound Name: | N-(4-ethoxyphenyl)-3-[2-(3-methylphenyl)acetamido]-1-benzofuran-2-carboxamide |
| Molecular Weight: | 428.49 |
| Molecular Formula: | C26 H24 N2 O4 |
| Smiles: | CCOc1ccc(cc1)NC(c1c(c2ccccc2o1)NC(Cc1cccc(C)c1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.3204 |
| logD: | 5.3179 |
| logSw: | -5.6068 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 60.461 |
| InChI Key: | QZCAQHRGVFPISF-UHFFFAOYSA-N |