N-{2-[(4-methylphenyl)carbamoyl]-1-benzofuran-3-yl}-2H-1,3-benzodioxole-5-carboxamide
Chemical Structure Depiction of
N-{2-[(4-methylphenyl)carbamoyl]-1-benzofuran-3-yl}-2H-1,3-benzodioxole-5-carboxamide
N-{2-[(4-methylphenyl)carbamoyl]-1-benzofuran-3-yl}-2H-1,3-benzodioxole-5-carboxamide
Compound characteristics
| Compound ID: | C686-1213 |
| Compound Name: | N-{2-[(4-methylphenyl)carbamoyl]-1-benzofuran-3-yl}-2H-1,3-benzodioxole-5-carboxamide |
| Molecular Weight: | 414.42 |
| Molecular Formula: | C24 H18 N2 O5 |
| Smiles: | Cc1ccc(cc1)NC(c1c(c2ccccc2o1)NC(c1ccc2c(c1)OCO2)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5789 |
| logD: | 4.5765 |
| logSw: | -4.4706 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 70.667 |
| InChI Key: | QVZAUJCDUFDKND-UHFFFAOYSA-N |