N-(2,4-dimethoxyphenyl)-3-(3,5-dimethylbenzamido)-1-benzofuran-2-carboxamide
Chemical Structure Depiction of
N-(2,4-dimethoxyphenyl)-3-(3,5-dimethylbenzamido)-1-benzofuran-2-carboxamide
N-(2,4-dimethoxyphenyl)-3-(3,5-dimethylbenzamido)-1-benzofuran-2-carboxamide
Compound characteristics
| Compound ID: | C686-1319 |
| Compound Name: | N-(2,4-dimethoxyphenyl)-3-(3,5-dimethylbenzamido)-1-benzofuran-2-carboxamide |
| Molecular Weight: | 444.49 |
| Molecular Formula: | C26 H24 N2 O5 |
| Smiles: | Cc1cc(C)cc(c1)C(Nc1c2ccccc2oc1C(Nc1ccc(cc1OC)OC)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.0266 |
| logD: | 4.8398 |
| logSw: | -4.9137 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 68.027 |
| InChI Key: | WETXHOSECBBYIF-UHFFFAOYSA-N |