3-(4-chlorophenyl)-1-[(4-methylphenyl)methyl][1]benzothieno[3,2-d]pyrimidine-2,4(1H,3H)-dione
Chemical Structure Depiction of
3-(4-chlorophenyl)-1-[(4-methylphenyl)methyl][1]benzothieno[3,2-d]pyrimidine-2,4(1H,3H)-dione
3-(4-chlorophenyl)-1-[(4-methylphenyl)methyl][1]benzothieno[3,2-d]pyrimidine-2,4(1H,3H)-dione
Compound characteristics
| Compound ID: | C688-0859 |
| Compound Name: | 3-(4-chlorophenyl)-1-[(4-methylphenyl)methyl][1]benzothieno[3,2-d]pyrimidine-2,4(1H,3H)-dione |
| Molecular Weight: | 432.93 |
| Molecular Formula: | C24 H17 Cl N2 O2 S |
| Smiles: | Cc1ccc(CN2C(N(C(c3c2c2ccccc2s3)=O)c2ccc(cc2)[Cl])=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 6.1145 |
| logD: | 6.1145 |
| logSw: | -6.1125 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 32.559 |
| InChI Key: | JAVLBCLEBZEABK-UHFFFAOYSA-N |