ethyl 5-[2-(4-fluorophenyl)acetamido]-1-(2-{[(4-fluorophenyl)acetyl]oxy}ethyl)-1H-pyrazole-4-carboxylate
Chemical Structure Depiction of
ethyl 5-[2-(4-fluorophenyl)acetamido]-1-(2-{[(4-fluorophenyl)acetyl]oxy}ethyl)-1H-pyrazole-4-carboxylate
ethyl 5-[2-(4-fluorophenyl)acetamido]-1-(2-{[(4-fluorophenyl)acetyl]oxy}ethyl)-1H-pyrazole-4-carboxylate
Compound characteristics
| Compound ID: | C691-0008 |
| Compound Name: | ethyl 5-[2-(4-fluorophenyl)acetamido]-1-(2-{[(4-fluorophenyl)acetyl]oxy}ethyl)-1H-pyrazole-4-carboxylate |
| Molecular Weight: | 471.46 |
| Molecular Formula: | C24 H23 F2 N3 O5 |
| Smiles: | CCOC(c1cnn(CCOC(Cc2ccc(cc2)F)=O)c1NC(Cc1ccc(cc1)F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3507 |
| logD: | 3.1195 |
| logSw: | -3.3855 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 77.902 |
| InChI Key: | RFYQIMHZNNXEPQ-UHFFFAOYSA-N |